ChemNet > CAS > 1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
| product Name |
thieno[3,2-b]thiophene-2-carboxylic acid |
| CAS No |
1723-27-9 |
| Molecular Formula |
C7H4O2S2 |
| Molecular Weight |
184.2355 |
| InChI |
InChI=1/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9) |
| Molecular Structure |
![1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid](https://images-a.chemnet.com/suppliers/chembase/332/33208.gif)
|
| Density |
1.601g/cm3 |
| Melting point |
218℃ |
| Boiling point |
386.7°C at 760 mmHg |
| Refractive index |
1.769 |
| Flash point |
187.6°C |
| Vapour Pressur |
1.14E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
